CAS 119673-50-6
:1-(4-FLUORO-PHENYL)-2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
Description:
1-(4-Fluoro-phenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, enhancing the compound's electronic properties and potentially influencing its reactivity. The two methyl groups at the 2 and 5 positions of the pyrrole contribute to its steric and electronic characteristics, while the aldehyde functional group at the 3-position is indicative of its potential reactivity in various chemical transformations, such as condensation reactions or nucleophilic additions. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its unique combination of functional groups may allow for diverse applications in organic synthesis and material science. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C13H12FNO
InChI:InChI=1/C13H12FNO/c1-9-7-11(8-16)10(2)15(9)13-5-3-12(14)4-6-13/h3-8H,1-2H3
SMILES:Cc1cc(C=O)c(C)n1c1ccc(cc1)F
Synonyms:- 1-(4-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde
- 1H-Pyrrole-3-carboxaldehyde, 1-(4-fluorophenyl)-2,5-dimethyl-
- 1-(4-Fluoro-phenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde
CAS:Formula:C13H12FNOMolecular weight:217.2389
