CAS 119691-75-7
:4-(β-D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide
Description:
4-(β-D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide, with the CAS number 119691-75-7, is a chemical compound that features a complex structure comprising a sulfonamide group, an isoxazole ring, and a glucopyranosyl moiety. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where sulfonamides are known for their antibacterial properties. The presence of the glucopyranosyl group suggests that it may exhibit properties related to carbohydrate chemistry, potentially influencing its solubility and interaction with biological systems. The isoxazole ring contributes to the compound's aromatic character and may play a role in its pharmacological effects. Overall, this compound's unique structural features may allow it to interact with specific biological targets, making it of interest in drug development and research into therapeutic applications. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further elucidated through various analytical methods.
Formula:C16H21N3O8S
InChI:InChI=1S/C16H21N3O8S/c1-8-6-12(18-27-8)19-28(24,25)10-4-2-9(3-5-10)17-16-15(23)14(22)13(21)11(7-20)26-16/h2-6,11,13-17,20-23H,7H2,1H3,(H,18,19)/t11-,13-,14+,15-,16-/m1/s1
InChI key:InChIKey=AKDUCXZSJFIYSD-YMILTQATSA-N
SMILES:N([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C2=CC=C(S(NC3=NOC(C)=C3)(=O)=O)C=C2
Synonyms:- Benzenesulfonamide, 4-(β-D-glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)-
- 4-(β-D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide
- Sulfamethoxazole N4-glucoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 6 products.
Sulfamethoxazole N4-Glucoside (4-(β-D-glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)-benzenesulfonamide)
CAS:Sulfonamides, nesoiFormula:C16H21N3O8SColor and Shape:White Off-White PowderMolecular weight:415.10494Sulfamethoxazole N4-glucoside (alpha/beta mixture)
CAS:Applications Sulfamethoxazole N4-glucoside is a metabolite of Sulfamethoxazole (S699086) which is an anti bacterial drug. Sulfonamide antibiotic that blocks the synthesis of dihydrofolic acid by inhibiting the enzyme dihydropteroate synthase.
References Rudy, B.C., et al.: Anal. Profiles Drug Subs., 2, 467 (1973), Wormser, G.P., et al.: Drugs, 24, 459 (1982), Wharton, M., et al.: Ann. Intern. Med., 105, 37 (1986),Formula:C16H21N3O8SColor and Shape:White To Light Orange ColourMolecular weight:415.42Sulfamethoxazole-d4 N4-glucoside
CAS:Controlled ProductFormula:C16D4H17N3O8SColor and Shape:NeatMolecular weight:419.443





