CAS 119691-75-7: 4-(β-D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide
Description:4-(β-D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide, with the CAS number 119691-75-7, is a chemical compound that features a complex structure comprising a sulfonamide group, an isoxazole ring, and a glucopyranosyl moiety. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where sulfonamides are known for their antibacterial properties. The presence of the glucopyranosyl group suggests that it may exhibit properties related to carbohydrate chemistry, potentially influencing its solubility and interaction with biological systems. The isoxazole ring contributes to the compound's aromatic character and may play a role in its pharmacological effects. Overall, this compound's unique structural features may allow it to interact with specific biological targets, making it of interest in drug development and research into therapeutic applications. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further elucidated through various analytical methods.
Formula:C16H21N3O8S
InChI:InChI=1S/C16H21N3O8S/c1-8-6-12(18-27-8)19-28(24,25)10-4-2-9(3-5-10)17-16-15(23)14(22)13(21)11(7-20)26-16/h2-6,11,13-17,20-23H,7H2,1H3,(H,18,19)/t11-,13-,14+,15-,16-/m1/s1
InChI key:InChIKey=AKDUCXZSJFIYSD-YMILTQATSA-N
SMILES:O=S(=O)(NC1=NOC(=C1)C)C2=CC=C(C=C2)NC3OC(CO)C(O)C(O)C3O
- Synonyms:
- Benzenesulfonamide, 4-(β-D-glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)-
- 4-(β-D-Glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)benzenesulfonamide
- Sulfamethoxazole N4-glucoside

Sulfamethoxazole N4-Glucoside (4-(β-D-glucopyranosylamino)-N-(5-methyl-3-isoxazolyl)-benzenesulfonamide)
Ref: 45-1631500
25mg | 1,371.00 € |

Ref: 4Z-S-503
5mg | 456.00 € | ||
10mg | 780.00 € | ||
25mg | 1,288.00 € | ||
50mg | 2,237.00 € | ||
100mg | 3,524.00 € |

Sulfamethoxazole N4-β-D-Glucoside
Controlled ProductRef: 86-MM0227.07-0025
25mg | 860.00 € |

Sulfamethoxazole N4-glucoside (α/β mixture)
Ref: TR-S688990
10mg | 365.00 € | ||
100mg | 2,427.00 € |

Sulfamethoxazole-d4 N4-glucoside
Controlled ProductRef: TR-S688992
100mg | 11,848.00 € |