CAS 1197-10-0

6-Hydroxymethyl-Pyridine-2-Carboxylic Acid

Description:

6-Hydroxymethyl-Pyridine-2-Carboxylic Acid, with the CAS number 1197-10-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and a carboxylic acid group (-COOH) attached to the pyridine ring, specifically at the 6 and 2 positions, respectively. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its polar functional groups. The presence of the hydroxymethyl and carboxylic acid groups contributes to its potential as a building block in organic synthesis and pharmaceutical applications. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its reactivity can be influenced by the functional groups, allowing for various chemical transformations. As with many pyridine derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₇NO₃

InChI: InChI=1/C7H7NO3/c9-4-5-2-1-3-6(8-5)7(10)11/h1-3,9H,4H2,(H,10,11)

SMILES: c1cc(CO)nc(c1)C(=O)O

Synonyms:

• 6-(Hydroxymethyl)Picolinic Acid

6-Hydroxymethyl-pyridine-2-carboxylic acid

CAS: 1197-10-0

Formula: C₇H₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA000PH3

6-(Hydroxymethyl)pyridine-2-carboxylic acid

CAS: 1197-10-0

6-(Hydroxymethyl)pyridine-2-carboxylic acid

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: white solid

Molecular weight: 153.14g/mol

Ref: 54-OR52053

6-(Hydroxymethyl)picolinic acid

CAS: 1197-10-0

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.137

Ref: 10-F046221