CAS 1197-54-2
:(4-Amino-cyclohexyl)-acetic acid
Description:
(4-Amino-cyclohexyl)-acetic acid, also known by its CAS number 1197-54-2, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group. This compound features a cyclohexane ring with an amino group positioned at the 4th carbon and an acetic acid moiety. It is typically a white to off-white crystalline solid that is soluble in water due to the polar nature of its functional groups. The presence of the amino group allows for potential interactions such as hydrogen bonding, which can influence its reactivity and solubility. This compound may be utilized in various applications, including pharmaceuticals and as a building block in organic synthesis. Its biological activity and potential therapeutic uses are subjects of interest in medicinal chemistry, particularly in the development of compounds with specific pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c9-7-3-1-6(2-4-7)5-8(10)11/h6-7H,1-5,9H2,(H,10,11)
SMILES:C1CC(CCC1CC(=O)O)N
Synonyms:- (4-Aminocyclohexyl)acetic acid
- Cyclohexaneacetic Acid, 4-Amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclohexaneacetic acid, 4-amino-
CAS:Formula:C8H15NO2Purity:97%Color and Shape:SolidMolecular weight:157.21022-(4-Aminocyclohexyl)acetic acid
CAS:2-(4-Aminocyclohexyl)acetic acidPurity:97%Molecular weight:157.21g/mol4-Aminocyclohexaneacetic acid
CAS:4-Aminocyclohexaneacetic acid (ACHA) is a reagent that is used in the industrial production of ethyl esters and carboxylic acids. It has been shown to be effective in the separation of these two compounds by high-performance liquid chromatography (HPLC). The diameter of the column, impeller speed and type of stationary phase are all factors that affect the efficiency of ACHA. HPLC analysis can also be used to separate isomers or stereoisomers. 4-Aminocyclohexaneacetic acid has been used as an intermediate for the synthesis of carbamates and other organic compounds. This chemical has a dehydrating effect on alkaloids, which are known to cause allergic reactions in humans when ingested orally.Formula:C8H15NO2Purity:Min. 95%Molecular weight:157.21 g/mol




