CAS 1197-66-6
:2,2,6,6-Tetramethyl-2H-3,5,6-trihydropyran-4-one
Description:
2,2,6,6-Tetramethyl-2H-3,5,6-trihydropyran-4-one, with CAS number 1197-66-6, is an organic compound characterized by its unique structure that includes a pyran ring and multiple methyl groups. This compound is typically a colorless to pale yellow liquid with a pleasant, fruity odor, making it of interest in flavor and fragrance applications. It is known for its stability and relatively low reactivity under standard conditions, which contributes to its utility in various chemical processes. The presence of the carbonyl group in the pyran ring enhances its potential for undergoing reactions such as nucleophilic addition. Additionally, its solubility in organic solvents allows for versatility in formulation. Due to its structural features, it may also exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. Overall, 2,2,6,6-Tetramethyl-2H-3,5,6-trihydropyran-4-one is a compound of interest in both synthetic organic chemistry and industrial applications.
Formula:C9H16O2
InChI:InChI=1/C9H16O2/c1-8(2)5-7(10)6-9(3,4)11-8/h5-6H2,1-4H3
SMILES:CC1(C)CC(=O)CC(C)(C)O1
Synonyms:- 2,2,6,6-Tetramethyltetrahydro-4H-pyran-4-one
- 4H-pyran-4-one, tetrahydro-2,2,6,6-tetramethyl-
- 2,2,6,6-Tetramethyl-Tetrahydropyran-4-One
- 2,2,6,6-Tetramethyloxan-4-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4H-Pyran-4-one, tetrahydro-2,2,6,6-tetramethyl-
CAS:Formula:C9H16O2Purity:97%Color and Shape:LiquidMolecular weight:156.22212,2,6,6-Tetramethyloxan-4-one
CAS:2,2,6,6-Tetramethyloxan-4-onePurity:97%Color and Shape:Colourless - Yellow LiquidMolecular weight:156.22g/mol2,2,6,6-Tetramethyl-2H-3,5,6-trihydropyran-4-one
CAS:Formula:C9H16O2Purity:98%Color and Shape:LiquidMolecular weight:156.2252,2,6,6-Tetramethyloxan-4-one
CAS:2,2,6,6-Tetramethyloxan-4-one is a reactive compound that is sensitive to light. It has been used as a probe for the detection of hydrogen peroxide in microscopy and fluorescence. 2,2,6,6-Tetramethyloxan-4-one is also used as a fluorophore in research. The potential use of this compound includes the detection of peroxide in transfer reactions or benzoic anhydride in functional theory studies.Formula:C9H16O2Purity:Min. 95%Molecular weight:156.22 g/mol



