
CAS 1197-72-4
:4-Hydroxypiperitone
Description:
4-Hydroxypiperitone is a chemical compound classified as a cyclic ketone and is part of the piperitone family. It is characterized by its unique bicyclic structure, which includes a hydroxyl group (-OH) attached to the piperitone framework. This compound is typically colorless to pale yellow in appearance and has a pleasant, minty aroma, making it of interest in the fragrance and flavor industries. Its molecular formula reflects the presence of carbon, hydrogen, and oxygen atoms, contributing to its functional properties. 4-Hydroxypiperitone exhibits solubility in organic solvents, which is common for many ketones and alcohols. Additionally, it may possess biological activity, including potential antimicrobial or antifungal properties, although specific studies on its pharmacological effects may be limited. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 4-Hydroxypiperitone is a compound of interest for both its chemical properties and potential applications in various industries.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c1-7(2)10(12)5-4-8(3)6-9(10)11/h6-7,12H,4-5H2,1-3H3
InChI key:InChIKey=JQBSYDHRTYUYCA-UHFFFAOYSA-N
SMILES:C(C)(C)C1(O)C(=O)C=C(C)CC1
Synonyms:- 2-Cyclohexen-1-one, 6-hydroxy-3-methyl-6-(1-methylethyl)-
- 4-Hydroxypiperitone
- p-Menth-1-en-3-one, 4-hydroxy-
- 6-Hydroxy-3-methyl-6-(1-methylethyl)-2-cyclohexen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Cyclohexen-1-one, 6-hydroxy-3-methyl-6-(1-methylethyl)-
CAS:Formula:C10H16O2Molecular weight:168.2328
