CAS 1197-80-4
:2-AZASPIRO[4.5]DECANE-1,3-DIONE
Description:
2-Azaspiro[4.5]decane-1,3-dione, with the CAS number 1197-80-4, is a bicyclic compound featuring a spiro structure that incorporates both nitrogen and carbon atoms. This compound is characterized by its unique spirocyclic framework, which consists of a nitrogen atom integrated into a saturated ring system. The presence of two carbonyl groups (diones) contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry. The nitrogen atom in the structure can influence the compound's basicity and potential interactions with biological targets. Additionally, the spiro configuration can impart distinct stereochemical properties, which may affect the compound's pharmacokinetics and dynamics. Overall, 2-Azaspiro[4.5]decane-1,3-dione represents a class of compounds that can serve as valuable intermediates in the synthesis of more complex molecules or as potential therapeutic agents.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c11-7-6-9(8(12)10-7)4-2-1-3-5-9/h1-6H2,(H,10,11,12)
SMILES:C1CCC2(CC1)CC(=NC2=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
2-Azaspiro[4.5]decane-1,3-dione
CAS:Controlled ProductApplications 2-azaspiro[4.5]decane-1,3-dione (cas# 1197-80-4) is related to gabapentin (G117250).
Formula:C9H13NO2Color and Shape:NeatMolecular weight:167.205



