CAS 1197-80-4

2-AZASPIRO[4.5]DECANE-1,3-DIONE

Description:

2-Azaspiro[4.5]decane-1,3-dione, with the CAS number 1197-80-4, is a bicyclic compound featuring a spiro structure that incorporates both nitrogen and carbon atoms. This compound is characterized by its unique spirocyclic framework, which consists of a nitrogen atom integrated into a saturated ring system. The presence of two carbonyl groups (diones) contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry. The nitrogen atom in the structure can influence the compound's basicity and potential interactions with biological targets. Additionally, the spiro configuration can impart distinct stereochemical properties, which may affect the compound's pharmacokinetics and dynamics. Overall, 2-Azaspiro[4.5]decane-1,3-dione represents a class of compounds that can serve as valuable intermediates in the synthesis of more complex molecules or as potential therapeutic agents.

Formula: C₉H₁₃NO₂

InChI: InChI=1/C9H13NO2/c11-7-6-9(8(12)10-7)4-2-1-3-5-9/h1-6H2,(H,10,11,12)

SMILES: C1CCC2(CC1)CC(=NC2=O)O

2-Azaspiro[4.5]decane-1,3-dione

CAS: 1197-80-4

Formula: C₉H₁₃NO₂

Color and Shape: Solid

Molecular weight: 167.2050

Ref: IN-DA000PHL

Gabapentin Impurity 32

CAS: 1197-80-4

Formula: C₉H₁₃NO₂

Molecular weight: 167.21

Ref: 4Z-G-1047

2-Azaspiro[4.5]decane-1,3-dione

Controlled Product

CAS: 1197-80-4

Applications 2-azaspiro[4.5]decane-1,3-dione (cas# 1197-80-4) is related to gabapentin (G117250).

Formula: C₉H₁₃NO₂

Color and Shape: Neat

Molecular weight: 167.205

Ref: TR-B407590

Gabapentine Impurity 35

CAS: 1197-80-4

Formula: C₉H₁₃NO₂

Molecular weight: 167.21

Ref: ST-EA-CP-G3057