
CAS 1197-92-8
:1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)ethanone
Description:
1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)ethanone, also known as "Tonalide," is an organic compound characterized by its ketone functional group and a cyclohexene ring structure. This substance is typically a colorless to pale yellow liquid with a pleasant, floral scent, making it valuable in the fragrance industry. Its molecular structure includes a cyclohexene moiety substituted with a ketone group, contributing to its aromatic properties. Tonalide is known for its stability and resistance to oxidation, which enhances its utility in various applications, including perfumes and personal care products. Additionally, it exhibits low volatility, which helps in prolonging the scent duration in formulations. The compound is generally considered safe for use in cosmetics and fragrances, although it should be handled with care, following appropriate safety guidelines. Its chemical properties, such as solubility and reactivity, make it an interesting subject for further research in organic chemistry and material science.
Formula:C11H18O
InChI:InChI=1S/C11H18O/c1-8-6-5-7-11(3,4)10(8)9(2)12/h5-7H2,1-4H3
InChI key:InChIKey=JFWUBIJMEUTTNA-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C(C)(C)CCCC1C
Synonyms:- 2,6,6-Trimethyl-1-cyclohexenyl methyl ketone
- Ketone, methyl 2,6,6-trimethyl-1-cyclohexen-1-yl
- Ethanone, 1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-
- 1-Acetyl-2,6,6-trimethyl-1-cyclohexene
- 1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
