CAS 1197-97-3
:(4-bromo-2-methylbutan-2-yl)benzene
Description:
(4-bromo-2-methylbutan-2-yl)benzene, with the CAS number 1197-97-3, is an organic compound characterized by its aromatic structure due to the presence of a benzene ring. This compound features a branched alkyl group, specifically a 2-methylbutan-2-yl group, which is substituted at the para position of the benzene ring with a bromine atom. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The branched alkyl chain contributes to its hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. Additionally, the compound's structure suggests it may exhibit interesting physical properties, such as boiling and melting points, which are typically influenced by the size and branching of the alkyl group as well as the presence of the bromine substituent. Overall, (4-bromo-2-methylbutan-2-yl)benzene is a versatile compound in organic synthesis and materials science.
Formula:C11H15Br
InChI:InChI=1/C11H15Br/c1-11(2,8-9-12)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3
SMILES:CC(C)(CCBr)c1ccccc1
Synonyms:- (4-bromo-2-methylbutan-2-yl)benzene
- 3-methyl-3-phenylbutyl bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
