CAS 119715-71-8

1,5,5-Trimethyl-2-pyrrolidinone

Description:

1,5,5-Trimethyl-2-pyrrolidinone, identified by its CAS number 119715-71-8, is a cyclic amide characterized by a five-membered ring structure containing a nitrogen atom. This compound features three methyl groups attached to the carbon atoms in the ring, which contributes to its unique chemical properties. It is a colorless to pale yellow liquid with a relatively high boiling point, indicating its stability at elevated temperatures. The presence of the nitrogen atom in the pyrrolidinone structure imparts polar characteristics, making it soluble in various organic solvents. This compound is often utilized as a solvent and a reagent in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its ability to act as a polar aprotic solvent enhances its utility in facilitating reactions that require a non-protic environment. Additionally, 1,5,5-trimethyl-2-pyrrolidinone exhibits low toxicity, making it a safer alternative in many applications compared to more hazardous solvents. Overall, its distinctive structure and properties make it a valuable compound in chemical processes.

Formula: C₇H₁₃NO

InChI: InChI=1S/C7H13NO/c1-7(2)5-4-6(9)8(7)3/h4-5H2,1-3H3

InChI key: InChIKey=YARDEGUIPATLSG-UHFFFAOYSA-N

SMILES: CN1C(C)(C)CCC1=O

Synonyms:

• 1,5,5-Trimethyl-2-pyrrolidinone
• 2-Pyrrolidinone, 1,5,5-trimethyl-