CAS 1197193-06-8
:3-Chloro-4-(1-piperazinyl)benzoic acid
Description:
3-Chloro-4-(1-piperazinyl)benzoic acid is a chemical compound characterized by its aromatic structure, which includes a chloro substituent and a piperazine moiety. This compound features a benzoic acid backbone, indicating the presence of a carboxylic acid functional group that contributes to its acidic properties. The chloro group introduces a halogen, which can influence the compound's reactivity and solubility. The piperazine ring, a six-membered heterocyclic structure containing two nitrogen atoms, is known for its biological activity and is often found in pharmaceuticals. This compound may exhibit various biological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of both the chloro and piperazine groups may enhance its pharmacokinetic properties, such as absorption and distribution. Overall, 3-Chloro-4-(1-piperazinyl)benzoic acid represents a versatile compound with potential utility in drug development and research.
Formula:C11H13ClN2O2
InChI:InChI=1S/C11H13ClN2O2/c12-9-7-8(11(15)16)1-2-10(9)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2,(H,15,16)
InChI key:InChIKey=IXUFWLAEWINGMN-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(C(O)=O)=C1)N2CCNCC2
Synonyms:- 3-Chloro-4-(1-piperazinyl)benzoic acid
- 3-Chloro-4-(piperazin-1-yl)benzoic acid
- Benzoic acid, 3-chloro-4-(1-piperazinyl)-
- 3-Chloro-4-piperazinobenzoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
