CAS 1197193-08-0

1-[3-(Methylsulfonyl)-4-nitrophenyl]piperazine

Description:

1-[3-(Methylsulfonyl)-4-nitrophenyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 4-nitrophenyl group and a methylsulfonyl substituent, contributing to its unique chemical properties. The presence of the nitro group typically imparts significant electron-withdrawing characteristics, influencing the compound's reactivity and potential biological activity. The methylsulfonyl group enhances solubility and may affect the compound's interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its structure suggests it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₁H₁₅N₃O₄S

InChI: InChI=1S/C11H15N3O4S/c1-19(17,18)11-8-9(2-3-10(11)14(15)16)13-6-4-12-5-7-13/h2-3,8,12H,4-7H2,1H3

InChI key: InChIKey=FHEOTKKERXQVSW-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=C(N(=O)=O)C=CC(=C1)N2CCNCC2

Synonyms:

• Piperazine, 1-[3-(methylsulfonyl)-4-nitrophenyl]-
• 1-[3-(Methylsulfonyl)-4-nitrophenyl]piperazine
• N-(3-Methylsulphonyl-4-nitrophenyl)piperazine

Piperazine, 1-[3-(methylsulfonyl)-4-nitrophenyl]-

CAS: 1197193-08-0

Formula: C₁₁H₁₅N₃O₄S

Purity: 95%

Molecular weight: 285.3195

Ref: IN-DA000PJ6

N-(3-Methylsulphonyl-4-nitrophenyl)piperazine

CAS: 1197193-08-0

Purity: >95%

Molecular weight: 285.3200073

Ref: 10-F636458