CAS 1197193-22-8
:4-(Methylsulfonyl)-2-(4-morpholinyl)benzaldehyde
Description:
4-(Methylsulfonyl)-2-(4-morpholinyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a morpholine ring. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound typically exhibits a white to off-white crystalline appearance and has a moderate molecular weight. It is often utilized in pharmaceutical research and development due to its potential as a building block in the synthesis of biologically active molecules. The morpholine moiety can contribute to the compound's pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's functional groups suggest it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C12H15NO4S
InChI:InChI=1S/C12H15NO4S/c1-18(15,16)11-3-2-10(9-14)12(8-11)13-4-6-17-7-5-13/h2-3,8-9H,4-7H2,1H3
InChI key:InChIKey=ZTKOJQXOJUJAMC-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=C(S(C)(=O)=O)C=C1)N2CCOCC2
Synonyms:- 4-(Methylsulfonyl)-2-(4-morpholinyl)benzaldehyde
- Benzaldehyde, 4-(methylsulfonyl)-2-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
