CAS 1197193-23-9
:3-(Methylsulfonyl)-4-(4-morpholinyl)benzaldehyde
Description:
3-(Methylsulfonyl)-4-(4-morpholinyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a methylsulfonyl moiety. The presence of the morpholine ring introduces a heterocyclic element, contributing to its potential biological activity. This compound typically exhibits properties such as solubility in polar organic solvents, and its molecular structure suggests it may engage in hydrogen bonding due to the sulfonyl and morpholine functionalities. The methylsulfonyl group can enhance the compound's reactivity and solubility, while the morpholine ring may influence its pharmacokinetic properties. As a benzaldehyde derivative, it may also participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific applications and biological activities would depend on further research and characterization.
Formula:C12H15NO4S
InChI:InChI=1S/C12H15NO4S/c1-18(15,16)12-8-10(9-14)2-3-11(12)13-4-6-17-7-5-13/h2-3,8-9H,4-7H2,1H3
InChI key:InChIKey=JKZKGXSAODKIFG-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=CC(C=O)=C1)N2CCOCC2
Synonyms:- 3-(Methylsulfonyl)-4-(4-morpholinyl)benzaldehyde
- Benzaldehyde, 3-(methylsulfonyl)-4-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
