CAS 1197193-30-8
:Ethyl5-bromopyrimidine-2-carboxylate
Description:
Ethyl 5-bromopyrimidine-2-carboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a bromine atom at the 5 position introduces a halogen substituent, enhancing its reactivity and potential applications in organic synthesis. The ethyl ester functional group at the 2 position contributes to its solubility in organic solvents and its utility in various chemical reactions, such as esterification and nucleophilic substitution. This compound is often used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its ability to undergo further transformations. Its molecular structure allows for diverse reactivity patterns, making it a valuable building block in medicinal chemistry. Additionally, the compound's properties, such as boiling point, melting point, and solubility, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety data should be consulted for handling and storage guidelines.
Formula:C7H7BrN2O2
InChI:InChI=1S/C7H7BrN2O2/c1-2-12-7(11)6-9-3-5(8)4-10-6/h3-4H,2H2,1H3
InChI key:CZQFHUXIWZYQGP-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NC=C(C=N1)Br
Synonyms:- Ethyl 5-Bromoprimidine-2-Carboxylate
- Ethyl-5-bromopyrimidine-2-carboxylate ISO 9001:2015 REACH
- 5-bromo-2-Pyrimidinecarboxylic acid ethyl ester
- Ethyl5-bromopyrimidine-2-carboxylate,95%
- 5-broMo-4-ethylpyriMidine-2-carboxylate
- Ethyl 5-bromopyrimidine-2-carboxyate ISO 9001:2015 REACH
- 2-Pyrimidinecarboxylic acid, 5-bromo-, ethyl ester
- Ethyl-5-bromopyrimidine-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 5-bromopyrimidine-2-carboxylate, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7BrN2O2Purity:95%Molecular weight:231.05Ethyl 5-bromopyrimidine-2-carboxylate
CAS:Formula:C7H7BrN2O2Purity:95%Color and Shape:SolidMolecular weight:231.0467Ethyl 5-bromopyrimidine-2-carboxylate
CAS:Ethyl 5-bromopyrimidine-2-carboxylateFormula:C7H7BrN2O2Purity:95%Color and Shape:SolidMolecular weight:231.05Ethyl 5-bromopyrimidine-2-carboxylate
CAS:Ethyl 5-bromopyrimidine-2-carboxylateFormula:C7H7BrN2O2Purity:95%Molecular weight:231.05Ethyl 5-bromopyrimidine-2-carboxyate
CAS:Formula:C7H7BrN2O2Purity:95%Color and Shape:SolidMolecular weight:231.049




