CAS 1197193-43-3

4-(4-Methyl-1-piperazinyl)-3-(methylsulfonyl)benzaldehyde

Description:

4-(4-Methyl-1-piperazinyl)-3-(methylsulfonyl)benzaldehyde is a chemical compound characterized by its complex structure, which includes a benzaldehyde moiety substituted with a methylsulfonyl group and a piperazine ring. The presence of the piperazine ring contributes to its potential biological activity, as piperazines are often found in pharmacologically active compounds. The methylsulfonyl group enhances the compound's solubility and may influence its reactivity and interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use. Further studies would be necessary to fully elucidate its properties, including its reactivity, solubility, and biological effects.

Formula: C₁₃H₁₈N₂O₃S

InChI: InChI=1S/C13H18N2O3S/c1-14-5-7-15(8-6-14)12-4-3-11(10-16)9-13(12)19(2,17)18/h3-4,9-10H,5-8H2,1-2H3

InChI key: InChIKey=IPTSXJWLSBUEPX-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=C(C=CC(C=O)=C1)N2CCN(C)CC2

Synonyms:

• Benzaldehyde, 4-(4-methyl-1-piperazinyl)-3-(methylsulfonyl)-
• 4-(4-Methyl-1-piperazinyl)-3-(methylsulfonyl)benzaldehyde