CAS 1197193-46-6: 7-Chloro-5-nitro-1H-indazol-3-amine
Description:7-Chloro-5-nitro-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 7-position and a nitro group at the 5-position contributes to its unique reactivity and potential biological activity. The amino group at the 3-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that may exhibit anti-cancer or anti-inflammatory properties. Its molecular structure allows for various substitution patterns, which can be explored to optimize its efficacy and selectivity. As with many nitro-containing compounds, it may also exhibit sensitivity to reduction reactions, leading to the formation of amines. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated and nitro compounds.
Formula:C7H5ClN4O2
InChI:InChI=1S/C7H5ClN4O2/c8-5-2-3(12(13)14)1-4-6(5)10-11-7(4)9/h1-2H,(H3,9,10,11)
InChI key:InChIKey=NTJSXPXNGMVYCV-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=C(Cl)C=2NN=C(N)C2C1
- Synonyms:
- 1H-Indazol-3-amine, 7-chloro-5-nitro-
- 7-Chloro-5-nitro-1H-indazol-3-amine
1H-Indazol-3-amine, 7-chloro-5-nitro-
Ref: IN-DA000PJP
| 100mg | 25.00 € | ||
| 250mg | 42.00 € |
Ref: 10-F822752
| 1g | 76.00 € | ||
| 5g | 302.00 € |
Ref: 10-F446651
| 1g | To inquire | ||
| 5g | To inquire |
3-Amino-7-chloro-5-nitro-1H-indazole
Ref: 3D-XXB19346
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
