CAS 119720-60-4
:(2R,3R)-3-aminononan-2-ol
Description:
(2R,3R)-3-aminononan-2-ol is an organic compound characterized by its chiral centers at the second and third carbon atoms, which contribute to its specific stereochemistry. This compound features a long carbon chain, making it a member of the aliphatic amines and alcohols. The presence of an amino group (-NH2) and a hydroxyl group (-OH) indicates that it can participate in hydrogen bonding, which may influence its solubility in polar solvents, such as water. The stereochemistry of (2R,3R) suggests that it has specific spatial arrangements that can affect its biological activity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and biochemistry, due to its potential role as a building block in the synthesis of more complex molecules or as a chiral auxiliary in asymmetric synthesis. Its properties, such as melting point, boiling point, and reactivity, would depend on the specific functional groups and the overall structure of the molecule.
Formula:C9H21NO
InChI:InChI=1/C9H21NO/c1-3-4-5-6-7-9(10)8(2)11/h8-9,11H,3-7,10H2,1-2H3/t8-,9-/m1/s1
SMILES:CCCCCC[C@H]([C@@H](C)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
