
CAS 1197227-24-9
:4-Acridinemethanamine, ethanedioate (1:1)
Description:
4-Acridinemethanamine, ethanedioate (1:1), with the CAS number 1197227-24-9, is a chemical compound that features an acridine moiety linked to a methanamine group, forming a unique structure that may exhibit interesting biological and chemical properties. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the acridine ring, which is known for its biological activity, including antitumor and antimicrobial effects. The ethanedioate (oxalate) component suggests that it may form salts or complexes, influencing its solubility and reactivity. The compound's stability, melting point, and solubility in various solvents can vary, depending on the specific conditions and the presence of other functional groups. As with many acridine derivatives, it may also exhibit fluorescence, making it useful in various analytical applications. However, detailed studies are necessary to fully understand its properties, mechanisms of action, and potential uses in various fields, including pharmaceuticals and materials science.
Formula:C14H12N2·C2H2O4
InChI:InChI=1S/C14H12N2.C2H2O4/c15-9-12-6-3-5-11-8-10-4-1-2-7-13(10)16-14(11)12;3-1(4)2(5)6/h1-8H,9,15H2;(H,3,4)(H,5,6)
InChI key:InChIKey=BDPNOCVHBTVJJX-UHFFFAOYSA-N
SMILES:C(N)C=1C2=C(C=C3C(=N2)C=CC=C3)C=CC1.C(C(O)=O)(O)=O
Synonyms:- 4-Acridinemethanamine, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.