CAS 1197227-82-9

6-Bromo-2-pyrazinecarboxaldehyde

Description:

6-Bromo-2-pyrazinecarboxaldehyde is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 6-position and an aldehyde functional group at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a pale yellow to brown solid and is soluble in polar organic solvents. It is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its ability to participate in nucleophilic addition reactions and other transformations. The aldehyde group makes it a versatile intermediate for further chemical modifications, allowing for the introduction of diverse functional groups. Additionally, the bromine substituent can serve as a site for cross-coupling reactions, enhancing its utility in synthetic chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling 6-Bromo-2-pyrazinecarboxaldehyde due to potential toxicity and environmental concerns.

Formula: C₅H₃BrN₂O

InChI: InChI=1S/C5H3BrN2O/c6-5-2-7-1-4(3-9)8-5/h1-3H

InChI key: InChIKey=RNJXCGCZAXKCOL-UHFFFAOYSA-N

SMILES: C(=O)C1=NC(Br)=CN=C1

Synonyms:

• 6-Bromo-2-pyrazinecarboxaldehyde
• 2-Pyrazinecarboxaldehyde, 6-bromo-