
CAS 1197231-35-8
:1-Naphthalenol, 4-amino-5,6,7,8-tetrahydro-, sulfate (1:1)
Description:
1-Naphthalenol, 4-amino-5,6,7,8-tetrahydro-, sulfate (1:1) is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and an amino group. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its functional groups. The presence of the sulfate moiety indicates that it may exhibit properties related to both naphthalenol and sulfate esters, potentially influencing its reactivity and biological activity. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-rich nature of the naphthalene ring. Additionally, the amino group can engage in hydrogen bonding and may affect the compound's solubility and interaction with biological systems. This compound's specific applications and biological significance would depend on its reactivity and the context in which it is used, such as in pharmaceuticals or as a chemical intermediate. Safety data and handling precautions should be consulted due to potential toxicity associated with similar compounds.
Formula:C10H13NO·H2O4S
InChI:InChI=1S/C10H13NO.H2O4S/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-5(2,3)4/h5-6,12H,1-4,11H2;(H2,1,2,3,4)
InChI key:InChIKey=QUQHGTZSMYHXGZ-UHFFFAOYSA-N
SMILES:NC1=C2C(=C(O)C=C1)CCCC2.S(=O)(=O)(O)O
Synonyms:- 1-Naphthalenol, 4-amino-5,6,7,8-tetrahydro-, sulfate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.