
CAS 1197233-09-2
:6-Azido-2,3-dihydro-1,4-benzodioxin
Description:
6-Azido-2,3-dihydro-1,4-benzodioxin is a chemical compound characterized by its unique structural features, including a benzodioxin core and an azido functional group. The presence of the azido group (-N3) imparts notable reactivity, making it a potential candidate for various synthetic applications, particularly in click chemistry and as a precursor for further functionalization. The benzodioxin moiety contributes to the compound's stability and may influence its solubility and interaction with other chemical species. Typically, compounds of this nature are studied for their potential use in pharmaceuticals, materials science, and organic synthesis due to their ability to participate in diverse chemical reactions. Safety considerations are paramount when handling such compounds, as azides can be sensitive and potentially explosive under certain conditions. Overall, 6-Azido-2,3-dihydro-1,4-benzodioxin represents a fascinating subject of study within the field of organic chemistry, with implications for both theoretical research and practical applications.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-11-10-6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5H,3-4H2
InChI key:InChIKey=NLBZPUUXYVPRLG-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C=1C=C2C(=CC1)OCCO2
Synonyms:- 3,4-Ethylenedioxyphenyl azide
- 6-Azido-2,3-dihydro-1,4-benzodioxin
- 1,4-Benzodioxin, 6-azido-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.