CAS 1197237-95-8: 2-Bromo-6-(trifluoromethyl)pyrazine
Description:2-Bromo-6-(trifluoromethyl)pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at opposite positions. The compound features a bromine atom at the 2-position and a trifluoromethyl group (-CF3) at the 6-position of the pyrazine ring, contributing to its unique chemical properties. The presence of the bromine atom introduces a halogen, which can enhance reactivity and influence the compound's physical properties, such as boiling and melting points. The trifluoromethyl group is known for its electron-withdrawing effects, which can significantly impact the compound's reactivity, making it useful in various synthetic applications. This compound is often utilized in medicinal chemistry and material science due to its potential biological activity and ability to participate in further chemical transformations. Its specific characteristics, such as solubility and stability, can vary based on the solvent and environmental conditions. Overall, 2-Bromo-6-(trifluoromethyl)pyrazine is a valuable compound in the field of organic synthesis and research.
Formula:C5H2BrF3N2
InChI:InChI=1S/C5H2BrF3N2/c6-4-2-10-1-3(11-4)5(7,8)9/h1-2H
InChI key:InChIKey=HUCJZLJSTLNVJK-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=NC(Br)=CN=C1
- Synonyms:
- Pyrazine, 2-bromo-6-(trifluoromethyl)-
- 2-Bromo-6-trifluoromethylpyrazine
- 2-Bromo-6-(trifluoromethyl)pyrazine
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Pyrazine, 2-bromo-6-(trifluoromethyl)-
Ref: IN-DA000PKB
1g | 603.00 € | ||
100mg | 197.00 € | ||
250mg | 239.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-Bromo-6-trifluoromethylpyrazine
Ref: 10-F075801
1g | 1,365.00 € | ||
250mg | 771.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-Bromo-6-trifluoromethylpyrazine
Ref: 3D-XXB23795
1g | 1,202.00 € | ||
100mg | 483.00 € |