CAS 1197237-96-9

1-Piperazinepropanamine, 4-propyl-, hydrochloride (1:3)

Description:

1-Piperazinepropanamine, 4-propyl-, hydrochloride (1:3) is a chemical compound characterized by its piperazine and propanamine functional groups, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the propyl group may influence its lipophilicity and interaction with biological targets. This compound is often studied for its potential in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests that it may exhibit properties such as basicity due to the piperazine ring, which can participate in hydrogen bonding and ionic interactions. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. As research continues, understanding its pharmacokinetics and pharmacodynamics will be crucial for evaluating its efficacy and safety in potential applications.

Formula: C₁₀H₂₃N₃·3ClH

InChI: InChI=1S/C10H23N3.3ClH/c1-2-5-12-7-9-13(10-8-12)6-3-4-11;;;/h2-11H2,1H3;3*1H

InChI key: InChIKey=LETGTIVRXAKCBJ-UHFFFAOYSA-N

SMILES: C(CCN)N1CCN(CCC)CC1.Cl

Synonyms:

• 1-Piperazinepropanamine, 4-propyl-, hydrochloride (1:3)

3-(4-Propylpiperazin-1-yl)propan-1-amine trihydrochloride

CAS: 1197237-96-9

Versatile small molecule scaffold

Formula: C₁₀H₂₆Cl₃N₃

Purity: Min. 95%

Molecular weight: 294.7 g/mol

Ref: 3D-XXB23796