CAS 119730-89-1
:baohuoside VII
Description:
Baohuoside VII, with the CAS number 119730-89-1, is a natural compound derived from the traditional Chinese medicinal plant, Baohuoshu (also known as the Baohuo tree). It belongs to the class of flavonoids, which are known for their diverse biological activities. This compound is characterized by its unique chemical structure, which typically includes multiple hydroxyl groups and a glycoside moiety, contributing to its solubility and reactivity. Baohuoside VII has garnered interest in pharmacological research due to its potential antioxidant, anti-inflammatory, and anticancer properties. Studies suggest that it may modulate various signaling pathways, enhancing its therapeutic potential. Additionally, its safety profile and bioavailability are subjects of ongoing research, as these factors are crucial for its application in medicinal chemistry. Overall, Baohuoside VII represents a promising candidate for further exploration in drug development and natural product chemistry.
Formula:C33H40O15
InChI:InChI=1/C33H40O15/c1-13(2)5-10-17-18(35)11-19(36)21-23(38)31(29(46-30(17)21)15-6-8-16(43-4)9-7-15)48-32-27(42)25(40)28(14(3)44-32)47-33-26(41)24(39)22(37)20(12-34)45-33/h5-9,11,14,20,22,24-28,32-37,39-42H,10,12H2,1-4H3/t14-,20-,22-,24-,25+,26-,27-,28+,32+,33+/m1/s1
Synonyms:- 3,5,7-(Trihydroxy)-4'-methoxyl-8-prenylflavone-3-O-rhamnopyranosyl(4-1)-glucopyranoside
- 4H-1-Benzopyran-4-one, 3-((6-deoxy-4-O-beta-D-glucopyranosyl-alpha-L-mannopyranosyl)oxy)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-butenyl)-
- 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-3-yl 4-O-beta-D-allopyranosyl-6-deoxy-beta-D-gulopyranoside
- Baohuoside VII
- 3-[(6-Deoxy-4-O-beta-D-glucopyranosyl-alpha-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one,3-[(6-deoxy-4-O-b-D-glucopyranosyl-a-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-
- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-4-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-
- baohuoside VII USP/EP/BP
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Baohuoside VII
CAS:Baohuoside aglycone reduces ischemic heart injury and infarction, protects bones in vivo against osteoporosis.Formula:C33H40O15Purity:98%Color and Shape:SolidMolecular weight:676.66Baohuoside VII
CAS:Formula:C33H40O15Purity:95%~99%Color and Shape:Yellow powderMolecular weight:676.668Baohuoside VII
CAS:<p>Baohuoside VII is a saponin derivative, which is a bioactive compound often found in various plant species, particularly those within the genus Icariin. Derived primarily from natural sources like the plant Epimedium, it exhibits a complex molecular structure. Baohuoside VII interacts with biological membranes and proteins, potentially altering their function and improving cellular uptake through its surfactant-like properties.</p>Purity:Min. 95%



