CAS 119736-19-5

1,4-Dihydro-1-methyl-4-oxo-5-(phenylmethoxy)-2-pyridinecarboxylic acid

Description:

1,4-Dihydro-1-methyl-4-oxo-5-(phenylmethoxy)-2-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and various functional groups. This substance features a dihydro-pyridine framework, indicating it has a saturated nitrogen-containing heterocycle, along with a ketone and a carboxylic acid functional group. The presence of a phenylmethoxy group suggests that it has aromatic characteristics, which can influence its reactivity and solubility. The compound's molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. It may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require empirical investigation. Additionally, the compound's solubility and stability can be affected by pH and solvent conditions, which are important considerations for its application in research or pharmaceutical development. Overall, this compound represents a complex organic molecule with potential utility in various chemical and biological contexts.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1S/C14H13NO4/c1-15-8-13(12(16)7-11(15)14(17)18)19-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,17,18)

InChI key: InChIKey=IZAWNXNVJUOJCZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N(C)C=C(OCC2=CC=CC=C2)C(=O)C1

Synonyms:

• 5-Benzyloxy-1-methyl-4-oxo-1,4-dihydropyridine-2-carboxylic acid
• 2-Pyridinecarboxylic acid, 1,4-dihydro-1-methyl-4-oxo-5-(phenylmethoxy)-
• 1,4-Dihydro-1-methyl-4-oxo-5-(phenylmethoxy)-2-pyridinecarboxylic acid
• 1-Methyl-4-oxo-5-phenylmethoxypyridine-2-carboxylic acid