CAS 119736-21-9
:4-Pyridinecarboxylic acid, 2-bromo-, 1-oxide
Description:
4-Pyridinecarboxylic acid, 2-bromo-, 1-oxide, also known by its CAS number 119736-21-9, is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a carboxylic acid group and a bromine atom. This compound features a nitrogen atom within the aromatic ring, contributing to its basicity and potential reactivity. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The bromine substituent can enhance the compound's reactivity, making it useful in synthetic organic chemistry, particularly in the formation of other derivatives. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its solubility in polar solvents and stability under standard conditions are typical for such compounds, although specific solubility and stability data would depend on the precise conditions and environment. Overall, 4-Pyridinecarboxylic acid, 2-bromo-, 1-oxide represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C6H4BrNO3
InChI:InChI=1S/C6H4BrNO3/c7-5-3-4(6(9)10)1-2-8(5)11/h1-3H,(H,9,10)
InChI key:InChIKey=CAPHJNXRVXJXDM-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(Br)N(=O)=CC1
Synonyms:- 2-Bromo-4-carboxypyridin-1-ium-1-olate
- 4-Pyridinecarboxylic acid, 2-bromo-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
