CAS 1197371-85-9

3-Hydrazinyl-2,6-dimethoxypyridine

Description:

3-Hydrazinyl-2,6-dimethoxypyridine is an organic compound characterized by the presence of a hydrazine functional group attached to a pyridine ring that is further substituted with two methoxy groups at the 2 and 6 positions. This compound typically exhibits properties associated with both hydrazines and pyridines, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as condensation and oxidation. The methoxy groups contribute to the compound's solubility and may influence its electronic properties, potentially enhancing its reactivity or stability. In terms of applications, compounds like 3-Hydrazinyl-2,6-dimethoxypyridine may be explored in medicinal chemistry for their potential biological activities, including antimicrobial or anticancer properties. Additionally, the presence of the pyridine ring may allow for coordination with metal ions, making it of interest in coordination chemistry. Overall, this compound represents a unique structure that may have diverse applications in both synthetic and medicinal chemistry.

Formula: C₇H₁₁N₃O₂

InChI: InChI=1S/C7H11N3O2/c1-11-6-4-3-5(10-8)7(9-6)12-2/h3-4,10H,8H2,1-2H3

InChI key: InChIKey=BQDYKJCCHCFPJX-UHFFFAOYSA-N

SMILES: O(C)C1=C(NN)C=CC(OC)=N1

Synonyms:

• 3-Hydrazinyl-2,6-dimethoxypyridine
• Pyridine, 3-hydrazinyl-2,6-dimethoxy-