CAS 1197377-87-9

6-Bromo-3-(2-methoxyethoxy)quinoline

Description:

6-Bromo-3-(2-methoxyethoxy)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a bromine atom at the 6-position introduces a halogen substituent, which can influence the compound's reactivity and potential applications in medicinal chemistry. The 3-position features a 2-methoxyethoxy group, which is an ether functional group that can enhance solubility and modify the compound's pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in drug discovery and development. Its molecular structure suggests potential interactions with biological targets, and the presence of both bromine and ether functionalities may contribute to its overall chemical behavior. As with many quinoline derivatives, it may possess properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Proper handling and safety measures should be observed due to the presence of bromine, which can be hazardous.

Formula: C₁₂H₁₂BrNO₂

InChI: InChI=1S/C12H12BrNO2/c1-15-4-5-16-11-7-9-6-10(13)2-3-12(9)14-8-11/h2-3,6-8H,4-5H2,1H3

InChI key: InChIKey=CXFYBIOKLKPJEK-UHFFFAOYSA-N

SMILES: O(CCOC)C1=CC2=C(N=C1)C=CC(Br)=C2

Synonyms:

• Quinoline, 6-bromo-3-(2-methoxyethoxy)-
• 6-Bromo-3-(2-methoxyethoxy)quinoline