CAS 119738-10-2

1,2,4-Oxadiazole, 3-butyl-5-(1-chloroethyl)-

Description:

1,2,4-Oxadiazole, 3-butyl-5-(1-chloroethyl)-, identified by CAS number 119738-10-2, is a heterocyclic compound featuring an oxadiazole ring, which is a five-membered aromatic structure containing two nitrogen atoms and three carbon atoms. This compound exhibits characteristics typical of oxadiazoles, including potential biological activity and stability under various conditions. The presence of the butyl group and the chloroethyl substituent contributes to its lipophilicity, which may influence its solubility and interaction with biological membranes. The chloroethyl group can also impart reactivity, making it a candidate for further chemical transformations or applications in medicinal chemistry. Additionally, compounds of this class are often investigated for their potential as pharmaceuticals, agrochemicals, or in materials science due to their unique electronic properties and ability to participate in various chemical reactions. Overall, 1,2,4-Oxadiazole, 3-butyl-5-(1-chloroethyl)- is a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₈H₁₃ClN₂O

InChI: InChI=1S/C8H13ClN2O/c1-3-4-5-7-10-8(6(2)9)12-11-7/h6H,3-5H2,1-2H3

InChI key: InChIKey=ZENRJUHCFROHJI-UHFFFAOYSA-N

SMILES: C(C)(Cl)C1=NC(CCCC)=NO1

Synonyms:

• 1,2,4-Oxadiazole, 3-butyl-5-(1-chloroethyl)-
• 3-Butyl-5-(1-chloroethyl)-1,2,4-oxadiazole
• 3-n-Butyl-5-(α-chloroethyl)-1,2,4-oxadiazole