CAS 119740-96-4

Methyl 3-[[(1,1-dimethylethoxy)carbonyl]methylamino]-2-(hydroxymethyl)propanoate

Description:

Methyl 3-[[(1,1-dimethylethoxy)carbonyl]methylamino]-2-(hydroxymethyl)propanoate, with CAS number 119740-96-4, is a chemical compound characterized by its complex structure, which includes a methyl ester functional group, an amino group, and a hydroxymethyl group. This compound is typically classified as an amino acid derivative due to the presence of the amino group, which can participate in various chemical reactions, including peptide bond formation. The presence of the dimethylethoxycarbonyl group suggests that it may be used as a protecting group in organic synthesis, particularly in the synthesis of more complex molecules. Its solubility properties are influenced by the ester and hydroxymethyl functionalities, making it potentially soluble in polar solvents. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Overall, its unique structural features make it a valuable compound in synthetic organic chemistry and potentially in medicinal chemistry.

Formula: C₁₁H₂₁NO₅

InChI: InChI=1S/C11H21NO5/c1-11(2,3)17-10(15)12(4)6-8(7-13)9(14)16-5/h8,13H,6-7H2,1-5H3

InChI key: InChIKey=KUNOSIAOXSNNTF-UHFFFAOYSA-N

SMILES: C(CN(C(OC(C)(C)C)=O)C)(C(OC)=O)CO

Synonyms:

• Propanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]methylamino]-2-(hydroxymethyl)-, methyl ester
• Propanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]methylamino]-2-(hydroxymethyl)-, methyl ester, (±)-
• Methyl 3-[[(1,1-dimethylethoxy)carbonyl]methylamino]-2-(hydroxymethyl)propanoate

Methyl 3-{[(tert-butoxy)carbonyl](methyl)amino}-2-(hydroxymethyl)propanoate

CAS: 119740-96-4

Versatile small molecule scaffold

Formula: C₁₁H₂₁NO₅

Purity: Min. 95%

Molecular weight: 247.29 g/mol

Ref: 3D-UEA74096