
CAS 1197420-06-6
:6-(4-Chlorophenyl)-3-[4-[(2R)-2-cyclopropyl-2-(phosphonooxy)ethoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4(3H)-one
Description:
The chemical substance known as "6-(4-Chlorophenyl)-3-[4-[(2R)-2-cyclopropyl-2-(phosphonooxy)ethoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4(3H)-one," with the CAS number 1197420-06-6, is a complex organic compound characterized by its multi-ring structure, which includes a thieno[3,2-d]pyrimidine core. This compound features various functional groups, including a chlorophenyl moiety and a phosphonooxy ethoxy side chain, contributing to its potential biological activity. The presence of the cyclopropyl group may influence its pharmacokinetic properties, while the methoxy and phosphono groups can enhance solubility and reactivity. Such structural characteristics suggest that this compound may exhibit significant interactions with biological targets, potentially making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as solubility, stability, and biological activity, would depend on the precise arrangement of its substituents and the overall molecular conformation. Further studies would be necessary to elucidate its full potential and applications.
Formula:C24H22ClN2O7PS
InChI:InChI=1S/C24H22ClN2O7PS/c1-32-20-10-17(8-9-19(20)33-12-21(14-2-3-14)34-35(29,30)31)27-13-26-18-11-22(36-23(18)24(27)28)15-4-6-16(25)7-5-15/h4-11,13-14,21H,2-3,12H2,1H3,(H2,29,30,31)/t21-/m0/s1
InChI key:InChIKey=YDTUJCNTIMWHPJ-NRFANRHFSA-N
SMILES:O=C1C2=C(C=C(S2)C3=CC=C(Cl)C=C3)N=CN1C4=CC(OC)=C(OC[C@H](OP(=O)(O)O)[C@H]5CC5)C=C4
Synonyms:- 6-(4-Chlorophenyl)-3-[4-[(2R)-2-cyclopropyl-2-(phosphonooxy)ethoxy]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4(3H)-one
- BMS 830216
- Thieno[3,2-d]pyrimidin-4(3H)-one, 6-(4-chlorophenyl)-3-[4-[(2R)-2-cyclopropyl-2-(phosphonooxy)ethoxy]-3-methoxyphenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BMS-830216
CAS:BMS-830216 is a nonbasic melanin hormone receptor 1 antagonist and a prodrug of BMS-819881.Formula:C24H22ClN2O7PSColor and Shape:SolidMolecular weight:548.93
