CAS 119757-57-2
:(E/E)-1-[4-(2-Chloroethoxy)phenyl]-1-(4-hydroxyphenyl)-2-phenyl-1-butene
Description:
The chemical substance known as (E/E)-1-[4-(2-Chloroethoxy)phenyl]-1-(4-hydroxyphenyl)-2-phenyl-1-butene, with the CAS number 119757-57-2, is a synthetic organic compound characterized by its complex structure featuring multiple aromatic rings and functional groups. This compound contains a butene backbone, which contributes to its potential reactivity and stability. The presence of a chloroethoxy group enhances its solubility in organic solvents, while the hydroxyphenyl group may impart hydrogen bonding capabilities, influencing its interactions in biological systems. The (E/E) configuration indicates the specific geometric arrangement of substituents around the double bond, which can significantly affect its chemical properties and biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Understanding its characteristics, including solubility, stability, and reactivity, is crucial for exploring its practical uses and safety profiles in various chemical contexts.
Formula:C24H23ClO2
InChI:InChI=1/C24H23ClO2/c1-2-23(18-6-4-3-5-7-18)24(19-8-12-21(26)13-9-19)20-10-14-22(15-11-20)27-17-16-25/h3-15,26H,2,16-17H2,1H3/b24-23+
Synonyms:- 4-[1-[4-(2-Chloroethoxy)Phenyl]-2-Phenyl-1-Butenyl]-Phenol
- (E/Z)-1-[4-(2-Chloroethoxy)phenyl]-1-(4-hydroxyphenyl)-2-phenyl-1-butene
- 4-[(E)-1-[4-(2-chloroethoxy)phenyl]-2-phenyl-but-1-enyl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Phenol, 4-[1-[4-(2-chloroethoxy)phenyl]-2-phenyl-1-buten-1-yl]-
CAS:Formula:C24H23ClO2Color and Shape:SolidMolecular weight:378.8912(E/Z)-1-[4-(2-Chloroethoxy)phenyl]-1-(4-hydroxyphenyl)-2-phenyl-1-butene
CAS:Controlled Product<p>Applications An intermediate in the syntheis of a metabolite of the anti-cancer drug Tamoxifen.<br></p>Formula:C24H23ClO2Color and Shape:NeatMolecular weight:378.89

