CAS 119767-00-9
:furan-3-ylmethyl 1H-pyrrole-2-carboxylate
Description:
Furan-3-ylmethyl 1H-pyrrole-2-carboxylate is an organic compound characterized by its unique structural features, which include a furan ring and a pyrrole moiety. This compound typically exhibits a molecular structure that allows for potential interactions in various chemical environments, making it of interest in medicinal chemistry and organic synthesis. The presence of the furan and pyrrole rings contributes to its aromatic properties, which can influence its reactivity and stability. Additionally, the carboxylate functional group enhances its solubility in polar solvents and may participate in hydrogen bonding, affecting its biological activity. Furan-3-ylmethyl 1H-pyrrole-2-carboxylate may also exhibit fluorescence properties, which can be useful in analytical applications. Its potential applications include use as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its behavior can be influenced by factors such as temperature, pH, and the presence of other chemical species.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c12-10(9-2-1-4-11-9)14-7-8-3-5-13-6-8/h1-6,11H,7H2
SMILES:c1cc(C(=O)OCc2ccoc2)[nH]c1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Furfuryl 2-pyrrolecarboxylate
CAS:3-Furfuryl 2-pyrrolecarboxylate, a chemical compound, is extracted from the root tuber of Pseudostellaria heterophylla.Formula:C10H9NO3Purity:98%Color and Shape:SolidMolecular weight:191.183-Furfuryl 2-pyrrolecarboxylate
CAS:Formula:C10H9NO3Purity:95%~99%Color and Shape:OilMolecular weight:191.1863-Furfuryl 2-pyrrolecarboxylate
CAS:3-Furfuryl 2-pyrrolecarboxylate is a heterophylla, a natural product. It is an aromatic compound with a molecular formula of C8H6O2. 3-Furfuryl 2-pyrrolecarboxylate has been shown to inhibit the growth of bacteria by binding to the 50S ribosomal subunit. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division.Formula:C10H9NO3Purity:Min. 95%Molecular weight:191.18 g/mol




