CAS 119771-21-0
:5'-deoxy-5'-fluoro-5'-(methylthio)adenosine
Description:
5'-Deoxy-5'-fluoro-5'-(methylthio)adenosine, with the CAS number 119771-21-0, is a modified nucleoside that features a fluorine atom and a methylthio group attached to the 5' position of the adenosine molecule. This compound is characterized by its structural modifications that enhance its stability and bioactivity compared to natural nucleosides. The presence of the fluorine atom can influence the compound's interaction with enzymes and receptors, potentially altering its pharmacological properties. The methylthio group may also contribute to its lipophilicity, affecting its cellular uptake and distribution. This nucleoside derivative is of interest in biochemical research and drug development, particularly in the context of antiviral and anticancer therapies, as it may exhibit unique mechanisms of action or improved efficacy. Its synthesis and characterization involve standard organic chemistry techniques, and it is typically analyzed using methods such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.
Formula:C11H14FN5O3S
InChI:InChI=1/C11H14FN5O3S/c1-21-8(12)7-5(18)6(19)11(20-7)17-3-16-4-9(13)14-2-15-10(4)17/h2-3,5-8,11,18-19H,1H3,(H2,13,14,15)/t5-,6+,7-,8+,11+/m0/s1
Synonyms:- 5'-Dfma
- Adenosine, 5'-C-fluoro-5'-S-methyl-5'-thio-, (5'R)-
- (5R)-5'-C-fluoro-5'-S-methyl-5'-thioadenosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Adenosine, 5'-C-fluoro-5'-S-methyl-5'-thio-, (5'R)- (9CI)
CAS:Formula:C11H14FN5O3SMolecular weight:315.3245'-Deoxy-5'-fluoro-5'-(methylthio)adenosine
CAS:<p>5'-Deoxy-5'-fluoro-5'-(methylthio)adenosine is an analogue of adenosine that has inhibitory activities on the biosynthetic pathway of polyamines. It has been shown to have a cytostatic effect on murine leukemia cells in vitro. 5'-Deoxy-5'-fluoro-5'-(methylthio)adenosine inhibits the production of polyamines by interfering with the enzyme responsible for their biosynthesis, ornithine decarboxylase. 5'-Deoxy-5'-fluoro-5'-(methylthio)adenosine also inhibits the growth of murine leukemia cells and other leukemia cell lines, including L1210 and MM1.</p>Formula:C11H14FN5O3SPurity:Min. 95%Molecular weight:315.33 g/mol

