CymitQuimica logo

CAS 119771-41-4

:

2-fluoroapomorphine

Description:
2-Fluoroapomorphine is a chemical compound that belongs to the class of apomorphine derivatives, which are known for their dopaminergic activity. It features a fluorine atom substituted at the second position of the apomorphine structure, which is derived from morphine. This modification can influence its pharmacological properties, potentially enhancing its affinity for dopamine receptors. The compound is typically characterized by its molecular formula, which reflects the presence of carbon, hydrogen, nitrogen, and fluorine atoms. 2-Fluoroapomorphine is of interest in medicinal chemistry, particularly for its potential applications in treating neurological disorders such as Parkinson's disease, where dopaminergic signaling is crucial. Its synthesis and characterization involve standard organic chemistry techniques, and it may exhibit specific solubility and stability profiles depending on the conditions. As with many fluorinated compounds, the introduction of fluorine can also affect the lipophilicity and metabolic stability, making it a subject of study in drug design and development.
Formula:C17H16FNO2
InChI:InChI=1/C17H16FNO2/c1-19-5-4-10-6-11(18)8-12-15(10)13(19)7-9-2-3-14(20)17(21)16(9)12/h2-3,6,8,13,20-21H,4-5,7H2,1H3/t13-/m1/s1
SMILES:CN1CCc2cc(cc3c2[C@H]1Cc1ccc(c(c31)O)O)F
Synonyms:
  • 4H-Dibenzo(de,g)quinoline-10,11-diol, 2-fluoro-5,6,6a,7-tetrahydro-6-methyl-, (R)-
  • (6aR)-2-fluoro-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol
  • 2-Fluoroapomorphine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.