CymitQuimica logo

CAS 119777-90-1

:

(2S)-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]-N-[(2S)-2-[[4-(trifluor omethyl)phenyl]amino]propanoyl]pentanamide

Description:
The chemical substance known as (2S)-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]-N-[(2S)-2-[[4-(trifluoromethyl)phenyl]amino]propanoyl]pentanamide, with the CAS number 119777-90-1, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a chiral center, which contributes to its potential biological activity and specificity in interactions with biological targets. The presence of trifluoroacetyl and trifluoromethyl groups indicates a high degree of fluorination, which can enhance lipophilicity and metabolic stability. This compound likely exhibits significant pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in targeting specific enzymes or receptors due to the presence of amide linkages and aromatic systems. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups, making it essential to consider these characteristics in any practical applications or synthesis processes.
Formula:C18H21F6N3O3
InChI:InChI=1/C18H21F6N3O3/c1-9(2)8-13(26-16(30)18(22,23)24)15(29)27-14(28)10(3)25-12-6-4-11(5-7-12)17(19,20)21/h4-7,9-10,13,25H,8H2,1-3H3,(H,26,30)(H,27,28,29)/t10-,13-/m0/s1
SMILES:CC(C)C[C@@H](C(=O)N=C([C@H](C)Nc1ccc(cc1)C(F)(F)F)O)N=C(C(F)(F)F)O
Synonyms:
  • Trifluoroacetyl-Leucyl-Alanyl-4-Trifluoromethylanilide
  • N~2~-(trifluoroacetyl)-N-[(2S)-2-{[4-(trifluoromethyl)phenyl]amino}propanoyl]-L-leucinamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.