CymitQuimica logo

CAS 119778-46-0

:

2-Methyl-4-(1-methylethyl)-5-thiazolecarboxylic acid

Description:
2-Methyl-4-(1-methylethyl)-5-thiazolecarboxylic acid, with the CAS number 119778-46-0, is an organic compound characterized by its thiazole ring structure, which incorporates both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methyl group and an isopropyl group on the thiazole ring enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. It is often studied for its biological activity, particularly in the context of agricultural chemistry, where it may serve as a precursor or intermediate in the synthesis of agrochemicals. The thiazole moiety is known for its role in various biochemical processes, making this compound of interest in medicinal chemistry as well. Additionally, its stability under standard conditions and potential for functionalization make it a valuable compound in synthetic organic chemistry. Overall, 2-Methyl-4-(1-methylethyl)-5-thiazolecarboxylic acid exhibits unique structural features that contribute to its chemical behavior and applications.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c1-4(2)6-7(8(10)11)12-5(3)9-6/h4H,1-3H3,(H,10,11)
InChI key:InChIKey=ARAQGFFKOMFFDE-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(C(O)=O)SC(C)=N1
Synonyms:
  • 2-Methyl-4-propan-2-yl-1,3-thiazole-5-carboxylic acid
  • 2-Methyl-4-(1-methylethyl)-5-thiazolecarboxylic acid
  • 5-Thiazolecarboxylic acid, 2-methyl-4-(1-methylethyl)-
  • 2-Methyl-4-(propan-2-yl)-1,3-thiazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.