CAS 119778-68-6
:2-cyclopropylquinoline-4-carbohydrazide
Description:
2-Cyclopropylquinoline-4-carbohydrazide is a chemical compound characterized by its unique structural features, which include a quinoline ring system and a cyclopropyl group. This compound belongs to the class of hydrazides, which are derivatives of hydrazine and are known for their diverse biological activities. The presence of the cyclopropyl moiety can influence the compound's reactivity and interaction with biological targets. Typically, compounds like 2-cyclopropylquinoline-4-carbohydrazide may exhibit properties such as moderate solubility in organic solvents and potential activity as a pharmacophore in medicinal chemistry. The compound may also be investigated for its potential applications in drug development, particularly in the context of anti-inflammatory or antimicrobial activities. As with many organic compounds, its stability, reactivity, and biological effects can be influenced by environmental factors such as pH and temperature. Further studies, including in vitro and in vivo evaluations, would be necessary to fully elucidate its characteristics and potential applications in various fields.
Formula:C13H13N3O
InChI:InChI=1/C13H13N3O/c14-16-13(17)10-7-12(8-5-6-8)15-11-4-2-1-3-9(10)11/h1-4,7-8H,5-6,14H2,(H,16,17)
SMILES:c1ccc2c(c1)c(cc(C1CC1)n2)C(=NN)O
Synonyms:- 4-Quinolinecarboxylic Acid, 2-Cyclopropyl-, Hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
