CAS 1197815-65-8

Spiro[piperidine-4,5′(7′H)-pyrano[3,2-c]pyrazol]-7′-one, 2′-(1,1-dimethylethyl)-2′,6′-dihydro-, hydrochloride (1:1)

Description:

Spiro[piperidine-4,5′(7′H)-pyrano[3,2-c]pyrazol]-7′-one, 2′-(1,1-dimethylethyl)-2′,6′-dihydro-, hydrochloride (1:1), identified by CAS number 1197815-65-8, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates a piperidine ring fused to a pyranopyrazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and interaction with biological targets. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous environments, facilitating its use in various applications, including drug formulation. The compound's specific pharmacological properties, such as its mechanism of action or therapeutic potential, would require further investigation through experimental studies. Overall, this substance represents a fascinating area of study within medicinal chemistry, particularly in the development of novel therapeutic agents.

Formula: C₁₄H₂₁N₃O₂·ClH

InChI: InChI=1S/C14H21N3O2.ClH/c1-13(2,3)17-9-11-12(16-17)10(18)8-14(19-11)4-6-15-7-5-14;/h9,15H,4-8H2,1-3H3;1H

InChI key: InChIKey=LVESAGWWWIILLK-UHFFFAOYSA-N

SMILES: O=C1CC2(OC=3C1=NN(C(C)(C)C)C3)CCNCC2.Cl

Synonyms:

• Spiro[piperidine-4,5′(7′H)-pyrano[3,2-c]pyrazol]-7′-one, 2′-(1,1-dimethylethyl)-2′,6′-dihydro-, hydrochloride (1:1)
• 2′-tert-Butyl-2′H-spiro[piperidine-4,5′-pyrano-[3,2-c]pyrazol]-7′(6′H)-one hydrochloride