CAS 1197943-71-7

5-Bromo-7-chloro-3-methyl-1H-indazole

Description:

5-Bromo-7-chloro-3-methyl-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of bromine and chlorine substituents at the 5 and 7 positions, respectively, contributes to its unique reactivity and potential biological activity. The methyl group at the 3 position further modifies its properties, influencing solubility and interaction with biological targets. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential as a pharmacophore in drug development. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Additionally, the presence of halogens can enhance its lipophilicity, affecting its bioavailability and interaction with cellular membranes. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₈H₆BrClN₂

InChI: InChI=1S/C8H6BrClN2/c1-4-6-2-5(9)3-7(10)8(6)12-11-4/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=INSPCFHVMNLUFF-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(Br)=C1)C(C)=NN2

Synonyms:

• 5-Bromo-7-chloro-3-methyl-1H-indazole
• 1H-Indazole, 5-bromo-7-chloro-3-methyl-