CAS 1197944-18-5

Methyl 1,2-benzisothiazole-5-carboxylate

Description:

Methyl 1,2-benzisothiazole-5-carboxylate is an organic compound characterized by its unique structure, which includes a benzisothiazole moiety and a carboxylate functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The presence of the isothiazole ring contributes to its reactivity and interaction with biological systems. Methyl 1,2-benzisothiazole-5-carboxylate may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which can influence its behavior in different environments. Additionally, it may possess antimicrobial or antifungal properties, making it of interest for research and development in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₇NO₂S

InChI: InChI=1S/C9H7NO2S/c1-12-9(11)6-2-3-8-7(4-6)5-10-13-8/h2-5H,1H3

InChI key: InChIKey=YSYWAAKOMAEXQT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C2C(=CC1)SN=C2

Synonyms:

• 1,2-Benzisothiazole-5-carboxylic acid, methyl ester
• Methyl 1,2-benzisothiazole-5-carboxylate

Methyl benzo[d]isothiazole-5-carboxylate

CAS: 1197944-18-5

Methyl benzo[d]isothiazole-5-carboxylate

Purity: 97%

Molecular weight: 193.23g/mol

Ref: 54-OR1069012