CAS 1197944-27-6

7-Hydroxy-2-methyl-5-benzoxazolecarboxylic acid

Description:

7-Hydroxy-2-methyl-5-benzoxazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a benzoxazole ring system and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity, making it a candidate for further chemical modifications. Additionally, the methyl group at the 2-position of the benzoxazole ring can affect the compound's electronic properties and steric hindrance, which may play a role in its biological activity. The compound's molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, 7-Hydroxy-2-methyl-5-benzoxazolecarboxylic acid is a versatile compound with characteristics that warrant further investigation for its functional applications.

Formula: C₉H₇NO₄

InChI: InChI=1S/C9H7NO4/c1-4-10-6-2-5(9(12)13)3-7(11)8(6)14-4/h2-3,11H,1H3,(H,12,13)

InChI key: InChIKey=AFDGDXVUAJLFFV-UHFFFAOYSA-N

SMILES: OC1=C2C(=CC(C(O)=O)=C1)N=C(C)O2

Synonyms:

• 5-Benzoxazolecarboxylic acid, 7-hydroxy-2-methyl-
• 7-Hydroxy-2-methyl-5-benzoxazolecarboxylic acid