CymitQuimica logo

CAS 1197944-61-8

:

7-Methoxy-2-methyl-5-benzoxazolecarboxylic acid

Description:
7-Methoxy-2-methyl-5-benzoxazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzoxazole ring, a methoxy group, and a carboxylic acid functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the methoxy group can influence its reactivity and polarity, while the carboxylic acid group may contribute to its acidity and ability to form salts or esters. The benzoxazole moiety is known for its applications in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, making it a versatile intermediate in synthetic organic chemistry. Its specific applications and behavior in biological systems would depend on further studies, including pharmacokinetics and toxicity assessments. Overall, 7-Methoxy-2-methyl-5-benzoxazolecarboxylic acid represents a compound of interest in both research and industrial contexts.
Formula:C10H9NO4
InChI:InChI=1S/C10H9NO4/c1-5-11-7-3-6(10(12)13)4-8(14-2)9(7)15-5/h3-4H,1-2H3,(H,12,13)
InChI key:InChIKey=DHPDWBACCVBDOB-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(C(O)=O)=C1)N=C(C)O2
Synonyms:
  • 5-Benzoxazolecarboxylic acid, 7-methoxy-2-methyl-
  • 7-Methoxy-2-methyl-5-benzoxazolecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.