CAS 1198-26-1

2-Methyl-3-hydroxy-4-(mercaptomethyl)-5-hydroxymethylpyridine hydrochl oride

Description:

2-Methyl-3-hydroxy-4-(mercaptomethyl)-5-hydroxymethylpyridine hydrochloride, with CAS number 1198-26-1, is a chemical compound that belongs to the class of pyridine derivatives. This substance features multiple functional groups, including hydroxyl (-OH) and thiol (-SH) groups, which contribute to its reactivity and potential biological activity. The presence of these groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or redox reactions. The hydrochloride form indicates that the compound is a salt, which typically enhances its solubility in water, making it more accessible for various applications. This compound may be of interest in pharmaceutical research due to its structural characteristics, which could influence its interaction with biological targets. Additionally, its unique functional groups may impart specific properties, such as antioxidant activity or the ability to form complexes with metal ions. Overall, 2-Methyl-3-hydroxy-4-(mercaptomethyl)-5-hydroxymethylpyridine hydrochloride is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₈H₁₂ClNO₂S

InChI: InChI=1/C8H11NO2S.ClH/c1-5-8(11)7(4-12)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H

Synonyms:

• 4-Mercaptomethyl-5-hydroxy-6-methyl-3-pyridinemethanol hydrochloride
• 4-Mercaptopyridoxin hydrochloride
• 3-Pyridinemethanol, 5-hydroxy-4-(mercaptomethyl)-6-methyl-, hydrochloride
• NSC 526970
• 5-(hydroxymethyl)-2-methyl-4-(sulfanylmethyl)pyridin-3-ol hydrochloride (1:1)
• 2-Methyl-3-hydroxy-4-mercaptomethyl-5-hydroxymethylpyridine hydrochloride
• 5-(hydroxymethyl)-2-methyl-4-(sulfanylmethyl)pyridin-3-ol