CymitQuimica logo

CAS 1198-31-8

:

3,4-Dihydro-8-methyl-2H-1,3-benzoxazin-2-one

Description:
3,4-Dihydro-8-methyl-2H-1,3-benzoxazin-2-one, with the CAS number 1198-31-8, is a chemical compound that belongs to the class of benzoxazines, which are characterized by a fused benzene and oxazine ring structure. This compound typically exhibits a white to pale yellow crystalline appearance. It is known for its potential applications in various fields, including agriculture as a natural herbicide and in materials science due to its polymerization properties. The presence of the methyl group at the 8-position contributes to its unique reactivity and stability. In terms of solubility, it is generally soluble in organic solvents but may have limited solubility in water. The compound can undergo various chemical reactions, including oxidation and polymerization, making it of interest for synthetic applications. Its biological activity and potential health effects are subjects of ongoing research, particularly in relation to its role in plant defense mechanisms and its environmental impact.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c1-6-3-2-4-7-5-10-9(11)12-8(6)7/h2-4H,5H2,1H3,(H,10,11)
InChI key:InChIKey=ACTHHUZPROIBPI-UHFFFAOYSA-N
SMILES:CC1=C2C(CNC(=O)O2)=CC=C1
Synonyms:
  • 3,4-Dihydro-8-methyl-2H-1,3-benzoxazin-2-one
  • 2H-1,3-Benzoxazin-2-one, 3,4-dihydro-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.