CAS 1198-50-1

3-(Bromomethyl)-5-methylbenzo[b]thiophene

Description:

3-(Bromomethyl)-5-methylbenzo[b]thiophene is an organic compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with a bromomethyl group and a methyl substituent. This compound typically exhibits a yellow to brown color and is known for its aromatic properties due to the presence of the benzene ring. The bromomethyl group introduces reactivity, making it a potential intermediate in various organic synthesis reactions, particularly in the formation of carbon-carbon bonds. The thiophene moiety contributes to its electronic properties, which can influence its behavior in chemical reactions and interactions with other substances. Additionally, the compound may exhibit moderate solubility in organic solvents, while its stability can be affected by environmental factors such as light and temperature. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 3-(Bromomethyl)-5-methylbenzo[b]thiophene serves as a valuable building block in synthetic organic chemistry.

Formula: C₁₀H₉BrS

InChI: InChI=1S/C10H9BrS/c1-7-2-3-10-9(4-7)8(5-11)6-12-10/h2-4,6H,5H2,1H3

InChI key: InChIKey=FGPYLHMAYRJFQM-UHFFFAOYSA-N

SMILES: C(Br)C=1C=2C(SC1)=CC=C(C)C2

Synonyms:

• 3-(Bromomethyl)-5-methylbenzo[b]thiophene
• Benzo[b]thiophene, 3-(bromomethyl)-5-methyl-

Benzo[b]thiophene, 3-(bromomethyl)-5-methyl-

CAS: 1198-50-1

Formula: C₁₀H₉BrS

Molecular weight: 241.1475

Ref: IN-DA000PNS