CAS 1198-56-7

1,2,3,5-Tetrachloro-4,6-difluorobenzene

Description:

1,2,3,5-Tetrachloro-4,6-difluorobenzene is an aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features four chlorine atoms and two fluorine atoms attached to the benzene structure, which significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its stability and resistance to degradation, making it useful in various industrial applications, including as a solvent or intermediate in chemical synthesis. The presence of halogens contributes to its reactivity, particularly in nucleophilic substitution reactions. Additionally, due to its chlorinated nature, it may exhibit environmental persistence and potential toxicity, necessitating careful handling and disposal. Its molecular structure leads to unique physical properties, such as a relatively high boiling point and density compared to non-halogenated benzene derivatives. Overall, 1,2,3,5-Tetrachloro-4,6-difluorobenzene is a significant compound in both industrial chemistry and environmental studies.

Formula: C₆Cl₄F₂

InChI: InChI=1S/C6Cl4F2/c7-1-2(8)5(11)4(10)6(12)3(1)9

InChI key: InChIKey=PVGPCHMQECZTIK-UHFFFAOYSA-N

SMILES: ClC1=C(Cl)C(F)=C(Cl)C(F)=C1Cl

Synonyms:

• m-Difluorotetrachlorobenzene
• 1,3-Difluoro-2,4,5,6-tetrachlorobenzene
• Benzene, 1,2,3,5-tetrachloro-4,6-difluoro-
• 1,3-Difluorotetrachlorobenzene
• 1,2,3,5-Tetrachloro-4,6-difluorobenzene