CAS 1198-60-3
:1,3,5-Trichlorobenzene-2,4,6-d3,98 atom % D
Description:
1,3,5-Trichlorobenzene-2,4,6-d3,98 atom % D is a deuterated derivative of trichlorobenzene, where the hydrogen atoms at the 2, 4, and 6 positions of the benzene ring are replaced with deuterium, a stable isotope of hydrogen. This compound is characterized by its three chlorine substituents, which significantly influence its chemical properties, including its reactivity and solubility. The presence of deuterium enhances its utility in various analytical techniques, such as nuclear magnetic resonance (NMR) spectroscopy, where it serves as a useful internal standard due to its distinct spectral characteristics compared to its non-deuterated counterparts. The high deuterium content (98 atom % D) indicates that the compound is predominantly composed of deuterium, which can affect its physical properties, such as boiling and melting points, compared to the non-deuterated version. 1,3,5-Trichlorobenzene-2,4,6-d3 is often used in research and industrial applications, particularly in studies involving isotopic labeling and tracing in chemical reactions.
Formula:C6D3Cl3
InChI:InChI=1/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H/i1D,2D,3D
SMILES:c1(c(c(c(c(c1Cl)[2H])Cl)[2H])Cl)[2H]
Synonyms:- 1,3,5-Trichlorobenzene-d3
- 1,3,5-Trichloro-2,4,6-Trideuterio-Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,5-Trichlorobenzene-D3 98 Atom % D 1 pack = 1g Bottle
CAS:1,3,5-Trichlorobenzene-D3 98 Atom % D 1 pack = 1g Bottle
Formula:C6Cl3D3Purity:98 Atom %Color and Shape: white crystalline solidMolecular weight:184.47g/mol1,3,5-Trichlorobenzene-d3
CAS:Formula:C6D3Cl3Purity:98 atom % DColor and Shape:White-Pale Yellow SolidMolecular weight:182.948861,3,5-Trichlorobenzene D3 100 µg/mL in Acetone
CAS:Controlled ProductFormula:C6H3Cl3Color and Shape:Single SolutionMolecular weight:184.471,3,5-Trichlorobenzene-d3
CAS:Controlled ProductApplications 1,3,5-Trichlorobenzene-d3 (CAS# 1198-60-3) is a useful isotopically labeled research compound.
Formula:C6D3Cl3Color and Shape:NeatMolecular weight:184.47



