CAS 1198-78-3

2-Bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine

Description:

2-Bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. The presence of bromine at the 2-position and methyl groups at the 5 and 7 positions contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic methyl groups. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the presence of the bromine atom. Its molecular structure allows for interactions with biological targets, making it of interest in drug discovery. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, 2-Bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₈H₈BrN₃

InChI: InChI=1S/C8H8BrN3/c1-5-3-6(2)12-8(10-5)4-7(9)11-12/h3-4H,1-2H3

InChI key: InChIKey=YYABKGZMJUSQEV-UHFFFAOYSA-N

SMILES: CC=1N2C(=CC(Br)=N2)N=C(C)C1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine, 2-bromo-5,7-dimethyl-
• 2-Bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine